C18H34N6 — CID 111741377
N-[2-(dimethylamino)-4-methylpentyl]-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide (PubChem CID 111741377) has the molecular formula C18H34N6 and a molecular weight of 334.51 g/mol. Its IUPAC name is N-[2-(dimethylamino)-4-methylpentyl]-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide.
| Compound Name | N-[2-(dimethylamino)-4-methylpentyl]-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111741377 |
| Molecular Formula | C18H34N6 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.28 |
| IUPAC Name | N-[2-(dimethylamino)-4-methylpentyl]-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(\NCC(CC(C)C)N(C)C)N1CCC(c2cnn(C)c2)C1 |
| InChI | InChI=1S/C18H34N6/c1-14(2)9-17(22(4)5)11-20-18(19-3)24-8-7-15(13-24)16-10-21-23(6)12-16/h10,12,14-15,17H,7-9,11,13H2,1-6H3,(H,19,20) |
| InChIKey | VRVFQLPPSCZPAC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 48.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|