C17H29N5 — CID 119143744
N-(2-cyclopentylethyl)-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide (PubChem CID 119143744) has the molecular formula C17H29N5 and a molecular weight of 303.45 g/mol. Its IUPAC name is N-(2-cyclopentylethyl)-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide.
| Compound Name | N-(2-cyclopentylethyl)-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 119143744 |
| Molecular Formula | C17H29N5 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.24 |
| IUPAC Name | N-(2-cyclopentylethyl)-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(\NCCC1CCCC1)N1CCC(c2cnn(C)c2)C1 |
| InChI | InChI=1S/C17H29N5/c1-18-17(19-9-7-14-5-3-4-6-14)22-10-8-15(13-22)16-11-20-21(2)12-16/h11-12,14-15H,3-10,13H2,1-2H3,(H,18,19) |
| InChIKey | PFEUMLOZOLTVPM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|