C14H23N5O2 — CID 111742283
methyl 3-[[N-methyl-C-[3-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]carbonimidoyl]amino]propanoate (PubChem CID 111742283) has the molecular formula C14H23N5O2 and a molecular weight of 293.37 g/mol. Its IUPAC name is methyl 3-[[N-methyl-C-[3-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]carbonimidoyl]amino]propanoate.
| Compound Name | methyl 3-[[N-methyl-C-[3-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]carbonimidoyl]amino]propanoate |
|---|---|
| PubChem CID | 111742283 |
| Molecular Formula | C14H23N5O2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | methyl 3-[[N-methyl-C-[3-(1-methylpyrazol-4-yl)pyrrolidin-1-yl]carbonimidoyl]amino]propanoate |
| SMILES | C/N=C(\NCCC(=O)OC)N1CCC(c2cnn(C)c2)C1 |
| InChI | InChI=1S/C14H23N5O2/c1-15-14(16-6-4-13(20)21-3)19-7-5-11(10-19)12-8-17-18(2)9-12/h8-9,11H,4-7,10H2,1-3H3,(H,15,16) |
| InChIKey | ZJPKLKDOVDRDEM-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 71.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|