C21H29F3IN5O2 — CID 111743602
N-ethyl-N'-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111743602) has the molecular formula C21H29F3IN5O2 and a molecular weight of 567.39 g/mol. Its IUPAC name is N-ethyl-N'-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111743602 |
| Molecular Formula | C21H29F3IN5O2 |
| Molecular Weight | 567.39 g/mol |
| Exact Mass | 567.13 |
| IUPAC Name | N-ethyl-N'-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OCC(F)(F)F)c(OC)c1)N1CCC(c2cnn(C)c2)C1.I |
| InChI | InChI=1S/C21H28F3N5O2.HI/c1-4-25-20(29-8-7-16(13-29)17-11-27-28(2)12-17)26-10-15-5-6-18(19(9-15)30-3)31-14-21(22,23)24;/h5-6,9,11-12,16H,4,7-8,10,13-14H2,1-3H3,(H,25,26);1H |
| InChIKey | UOHLBKJZBCVDDB-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 63.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|