C19H28F3N3O2 — CID 111959457
4-ethoxy-N-ethyl-N'-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]piperidine-1-carboximidamide (PubChem CID 111959457) has the molecular formula C19H28F3N3O2 and a molecular weight of 387.45 g/mol. Its IUPAC name is 4-ethoxy-N-ethyl-N'-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]piperidine-1-carboximidamide.
| Compound Name | 4-ethoxy-N-ethyl-N'-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111959457 |
| Molecular Formula | C19H28F3N3O2 |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 4-ethoxy-N-ethyl-N'-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]piperidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1cccc(OCC(F)(F)F)c1)N1CCC(OCC)CC1 |
| InChI | InChI=1S/C19H28F3N3O2/c1-3-23-18(25-10-8-16(9-11-25)26-4-2)24-13-15-6-5-7-17(12-15)27-14-19(20,21)22/h5-7,12,16H,3-4,8-11,13-14H2,1-2H3,(H,23,24) |
| InChIKey | WVHQDSNAQNEZNQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|