C16H23F3IN3O — CID 110955435
N-ethyl-N'-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 110955435) has the molecular formula C16H23F3IN3O and a molecular weight of 457.28 g/mol. Its IUPAC name is N-ethyl-N'-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110955435 |
| Molecular Formula | C16H23F3IN3O |
| Molecular Weight | 457.28 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | N-ethyl-N'-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OCC(F)(F)F)cc1)N1CCCC1.I |
| InChI | InChI=1S/C16H22F3N3O.HI/c1-2-20-15(22-9-3-4-10-22)21-11-13-5-7-14(8-6-13)23-12-16(17,18)19;/h5-8H,2-4,9-12H2,1H3,(H,20,21);1H |
| InChIKey | KSVRJPWDSVRWBI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.28 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|