C17H25F3N4O — CID 111145372
N-ethyl-3-methyl-N'-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]piperidine-1-carboximidamide (PubChem CID 111145372) has the molecular formula C17H25F3N4O and a molecular weight of 358.41 g/mol. Its IUPAC name is N-ethyl-3-methyl-N'-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]piperidine-1-carboximidamide.
| Compound Name | N-ethyl-3-methyl-N'-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111145372 |
| Molecular Formula | C17H25F3N4O |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | N-ethyl-3-methyl-N'-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]piperidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc(OCC(F)(F)F)nc1)N1CCCC(C)C1 |
| InChI | InChI=1S/C17H25F3N4O/c1-3-21-16(24-8-4-5-13(2)11-24)23-10-14-6-7-15(22-9-14)25-12-17(18,19)20/h6-7,9,13H,3-5,8,10-12H2,1-2H3,(H,21,23) |
| InChIKey | MKHVXFFPLXXZMG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|