C21H28N4O3 — CID 111549822
(3R)-N-ethyl-3-hydroxy-N'-[[6-(2-phenoxyethoxy)-3-pyridinyl]methyl]pyrrolidine-1-carboximidamide (PubChem CID 111549822) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is (3R)-N-ethyl-3-hydroxy-N'-[[6-(2-phenoxyethoxy)-3-pyridinyl]methyl]pyrrolidine-1-carboximidamide.
| Compound Name | (3R)-N-ethyl-3-hydroxy-N'-[[6-(2-phenoxyethoxy)-3-pyridinyl]methyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111549822 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | (3R)-N-ethyl-3-hydroxy-N'-[[6-(2-phenoxyethoxy)-3-pyridinyl]methyl]pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc(OCCOc2ccccc2)nc1)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C21H28N4O3/c1-2-22-21(25-11-10-18(26)16-25)24-15-17-8-9-20(23-14-17)28-13-12-27-19-6-4-3-5-7-19/h3-9,14,18,26H,2,10-13,15-16H2,1H3,(H,22,24)/t18-/m1/s1 |
| InChIKey | ZVDWZYDTNBEVGS-GOSISDBHSA-N |
| XLogP | 2.07 |
| TPSA | 79.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|