C21H33IN4O4 — CID 111587546
2-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-1-ethyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 111587546) has the molecular formula C21H33IN4O4 and a molecular weight of 532.42 g/mol. Its IUPAC name is 2-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-1-ethyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-1-ethyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111587546 |
| Molecular Formula | C21H33IN4O4 |
| Molecular Weight | 532.42 g/mol |
| Exact Mass | 532.15 |
| IUPAC Name | 2-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-1-ethyl-3-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(OC)c(OCC)c(OC)c1)NCc1cc(C(C)C)no1.I |
| InChI | InChI=1S/C21H32N4O4.HI/c1-7-22-21(24-13-16-11-17(14(3)4)25-29-16)23-12-15-9-18(26-5)20(28-8-2)19(10-15)27-6;/h9-11,14H,7-8,12-13H2,1-6H3,(H2,22,23,24);1H |
| InChIKey | YOCMONIPWLUUFU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|