C20H29N7O2 — CID 111951549
N-(2-amino-2-oxoethyl)-4-[[[ethylamino-[(1,3,5-trimethylpyrazol-4-yl)methylamino]methylidene]amino]methyl]benzamide (PubChem CID 111951549) has the molecular formula C20H29N7O2 and a molecular weight of 399.50 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-4-[[[ethylamino-[(1,3,5-trimethylpyrazol-4-yl)methylamino]methylidene]amino]methyl]benzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-4-[[[ethylamino-[(1,3,5-trimethylpyrazol-4-yl)methylamino]methylidene]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111951549 |
| Molecular Formula | C20H29N7O2 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-4-[[[ethylamino-[(1,3,5-trimethylpyrazol-4-yl)methylamino]methylidene]amino]methyl]benzamide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)NCC(N)=O)cc1)NCc1c(C)nn(C)c1C |
| InChI | InChI=1S/C20H29N7O2/c1-5-22-20(25-11-17-13(2)26-27(4)14(17)3)24-10-15-6-8-16(9-7-15)19(29)23-12-18(21)28/h6-9H,5,10-12H2,1-4H3,(H2,21,28)(H,23,29)(H2,22,24,25) |
| InChIKey | GRBCKVQNZBWABC-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|