C18H24IN5O2S — CID 111939708
N-(2-amino-2-oxoethyl)-4-[[[N-ethyl-N'-(thiophen-3-ylmethyl)carbamimidoyl]amino]methyl]benzamide;hydroiodide (PubChem CID 111939708) has the molecular formula C18H24IN5O2S and a molecular weight of 501.39 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-4-[[[N-ethyl-N'-(thiophen-3-ylmethyl)carbamimidoyl]amino]methyl]benzamide;hydroiodide.
| Compound Name | N-(2-amino-2-oxoethyl)-4-[[[N-ethyl-N'-(thiophen-3-ylmethyl)carbamimidoyl]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111939708 |
| Molecular Formula | C18H24IN5O2S |
| Molecular Weight | 501.39 g/mol |
| Exact Mass | 501.07 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-4-[[[N-ethyl-N'-(thiophen-3-ylmethyl)carbamimidoyl]amino]methyl]benzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccsc1)NCc1ccc(C(=O)NCC(N)=O)cc1.I |
| InChI | InChI=1S/C18H23N5O2S.HI/c1-2-20-18(23-10-14-7-8-26-12-14)22-9-13-3-5-15(6-4-13)17(25)21-11-16(19)24;/h3-8,12H,2,9-11H2,1H3,(H2,19,24)(H,21,25)(H2,20,22,23);1H |
| InChIKey | CFXMZNPPMIGSET-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|