C22H30N4O — CID 111649470
4-[[[[2-(3,5-dimethylphenyl)ethylamino]-(ethylamino)methylidene]amino]methyl]-N-methylbenzamide (PubChem CID 111649470) has the molecular formula C22H30N4O and a molecular weight of 366.51 g/mol. Its IUPAC name is 4-[[[[2-(3,5-dimethylphenyl)ethylamino]-(ethylamino)methylidene]amino]methyl]-N-methylbenzamide.
| Compound Name | 4-[[[[2-(3,5-dimethylphenyl)ethylamino]-(ethylamino)methylidene]amino]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 111649470 |
| Molecular Formula | C22H30N4O |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 4-[[[[2-(3,5-dimethylphenyl)ethylamino]-(ethylamino)methylidene]amino]methyl]-N-methylbenzamide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)NC)cc1)NCCc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C22H30N4O/c1-5-24-22(25-11-10-19-13-16(2)12-17(3)14-19)26-15-18-6-8-20(9-7-18)21(27)23-4/h6-9,12-14H,5,10-11,15H2,1-4H3,(H,23,27)(H2,24,25,26) |
| InChIKey | XRCCWWGNQJJKGJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|