C22H32N4O2S — CID 111321824
1-ethyl-2-[(1-methylsulfonylpiperidin-4-yl)methyl]-3-(1-naphthalen-2-ylethyl)guanidine (PubChem CID 111321824) has the molecular formula C22H32N4O2S and a molecular weight of 416.59 g/mol. Its IUPAC name is 1-ethyl-2-[(1-methylsulfonylpiperidin-4-yl)methyl]-3-(1-naphthalen-2-ylethyl)guanidine.
| Compound Name | 1-ethyl-2-[(1-methylsulfonylpiperidin-4-yl)methyl]-3-(1-naphthalen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111321824 |
| Molecular Formula | C22H32N4O2S |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 1-ethyl-2-[(1-methylsulfonylpiperidin-4-yl)methyl]-3-(1-naphthalen-2-ylethyl)guanidine |
| SMILES | CCN/C(=N\CC1CCN(S(C)(=O)=O)CC1)NC(C)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H32N4O2S/c1-4-23-22(24-16-18-11-13-26(14-12-18)29(3,27)28)25-17(2)20-10-9-19-7-5-6-8-21(19)15-20/h5-10,15,17-18H,4,11-14,16H2,1-3H3,(H2,23,24,25) |
| InChIKey | GBIUYANUPWDZRG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|