C22H28F3N3O3 — CID 111324112
2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-1-ethyl-3-[1-[3-(trifluoromethyl)phenyl]ethyl]guanidine (PubChem CID 111324112) has the molecular formula C22H28F3N3O3 and a molecular weight of 439.48 g/mol. Its IUPAC name is 2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-1-ethyl-3-[1-[3-(trifluoromethyl)phenyl]ethyl]guanidine.
| Compound Name | 2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-1-ethyl-3-[1-[3-(trifluoromethyl)phenyl]ethyl]guanidine |
|---|---|
| PubChem CID | 111324112 |
| Molecular Formula | C22H28F3N3O3 |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-1-ethyl-3-[1-[3-(trifluoromethyl)phenyl]ethyl]guanidine |
| SMILES | CCN/C(=N\CC(O)c1cc(OC)ccc1OC)NC(C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H28F3N3O3/c1-5-26-21(28-14(2)15-7-6-8-16(11-15)22(23,24)25)27-13-19(29)18-12-17(30-3)9-10-20(18)31-4/h6-12,14,19,29H,5,13H2,1-4H3,(H2,26,27,28) |
| InChIKey | VRSOZXALRIMSPI-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|