C24H32N4O3 — CID 111341525
2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-1-ethyl-3-(3-indol-1-ylpropyl)guanidine (PubChem CID 111341525) has the molecular formula C24H32N4O3 and a molecular weight of 424.55 g/mol. Its IUPAC name is 2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-1-ethyl-3-(3-indol-1-ylpropyl)guanidine.
| Compound Name | 2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-1-ethyl-3-(3-indol-1-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111341525 |
| Molecular Formula | C24H32N4O3 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | 2-[2-(2,5-dimethoxyphenyl)-2-hydroxyethyl]-1-ethyl-3-(3-indol-1-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(O)c1cc(OC)ccc1OC)NCCCn1ccc2ccccc21 |
| InChI | InChI=1S/C24H32N4O3/c1-4-25-24(26-13-7-14-28-15-12-18-8-5-6-9-21(18)28)27-17-22(29)20-16-19(30-2)10-11-23(20)31-3/h5-6,8-12,15-16,22,29H,4,7,13-14,17H2,1-3H3,(H2,25,26,27) |
| InChIKey | VHHUPVLCEFBDTE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|