C10H13NO5S — CID 117401516
2-amino-1-(6-methylsulfonyl-1,3-benzodioxol-5-yl)ethanol (PubChem CID 117401516) has the molecular formula C10H13NO5S and a molecular weight of 259.28 g/mol. Its IUPAC name is 2-amino-1-(6-methylsulfonyl-1,3-benzodioxol-5-yl)ethanol.
| Compound Name | 2-amino-1-(6-methylsulfonyl-1,3-benzodioxol-5-yl)ethanol |
|---|---|
| PubChem CID | 117401516 |
| Molecular Formula | C10H13NO5S |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 2-amino-1-(6-methylsulfonyl-1,3-benzodioxol-5-yl)ethanol |
| SMILES | CS(=O)(=O)c1cc2c(cc1C(O)CN)OCO2 |
| InChI | InChI=1S/C10H13NO5S/c1-17(13,14)10-3-9-8(15-5-16-9)2-6(10)7(12)4-11/h2-3,7,12H,4-5,11H2,1H3 |
| InChIKey | YUAUYPMAUAAWOI-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |