C12H15FO3 — CID 84690463
1-[6-(2-fluoropropan-2-yl)-1,3-benzodioxol-5-yl]ethanol (PubChem CID 84690463) has the molecular formula C12H15FO3 and a molecular weight of 226.25 g/mol. Its IUPAC name is 1-[6-(2-fluoropropan-2-yl)-1,3-benzodioxol-5-yl]ethanol.
| Compound Name | 1-[6-(2-fluoropropan-2-yl)-1,3-benzodioxol-5-yl]ethanol |
|---|---|
| PubChem CID | 84690463 |
| Molecular Formula | C12H15FO3 |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 1-[6-(2-fluoropropan-2-yl)-1,3-benzodioxol-5-yl]ethanol |
| SMILES | CC(O)c1cc2c(cc1C(C)(C)F)OCO2 |
| InChI | InChI=1S/C12H15FO3/c1-7(14)8-4-10-11(16-6-15-10)5-9(8)12(2,3)13/h4-5,7,14H,6H2,1-3H3 |
| InChIKey | PQFKCTKUFDQSJH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |