C10H11BrO3 — CID 84709686
2-(6-bromo-1,3-benzodioxol-5-yl)propan-2-ol (PubChem CID 84709686) has the molecular formula C10H11BrO3 and a molecular weight of 259.10 g/mol. Its IUPAC name is 2-(6-bromo-1,3-benzodioxol-5-yl)propan-2-ol.
| Compound Name | 2-(6-bromo-1,3-benzodioxol-5-yl)propan-2-ol |
|---|---|
| PubChem CID | 84709686 |
| Molecular Formula | C10H11BrO3 |
| Molecular Weight | 259.10 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | 2-(6-bromo-1,3-benzodioxol-5-yl)propan-2-ol |
| SMILES | CC(C)(O)c1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C10H11BrO3/c1-10(2,12)6-3-8-9(4-7(6)11)14-5-13-8/h3-4,12H,5H2,1-2H3 |
| InChIKey | VYYPZUAQZZQOAN-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.10 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |