C10H11BrO4 — CID 11054906
5-bromo-6-(dimethoxymethyl)-1,3-benzodioxole (PubChem CID 11054906) has the molecular formula C10H11BrO4 and a molecular weight of 275.10 g/mol. Its IUPAC name is 5-bromo-6-(dimethoxymethyl)-1,3-benzodioxole.
| Compound Name | 5-bromo-6-(dimethoxymethyl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 11054906 |
| Molecular Formula | C10H11BrO4 |
| Molecular Weight | 275.10 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | 5-bromo-6-(dimethoxymethyl)-1,3-benzodioxole |
| SMILES | COC(OC)c1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C10H11BrO4/c1-12-10(13-2)6-3-8-9(4-7(6)11)15-5-14-8/h3-4,10H,5H2,1-2H3 |
| InChIKey | WQUCNWOIPGCTCL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.10 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|