C22H26O5S — CID 11269651
cycloheptyl-[6-(4-methylsulfonylphenyl)-1,3-benzodioxol-5-yl]methanol (PubChem CID 11269651) has the molecular formula C22H26O5S and a molecular weight of 402.51 g/mol. Its IUPAC name is cycloheptyl-[6-(4-methylsulfonylphenyl)-1,3-benzodioxol-5-yl]methanol.
| Compound Name | cycloheptyl-[6-(4-methylsulfonylphenyl)-1,3-benzodioxol-5-yl]methanol |
|---|---|
| PubChem CID | 11269651 |
| Molecular Formula | C22H26O5S |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | cycloheptyl-[6-(4-methylsulfonylphenyl)-1,3-benzodioxol-5-yl]methanol |
| SMILES | CS(=O)(=O)c1ccc(-c2cc3c(cc2C(O)C2CCCCCC2)OCO3)cc1 |
| InChI | InChI=1S/C22H26O5S/c1-28(24,25)17-10-8-15(9-11-17)18-12-20-21(27-14-26-20)13-19(18)22(23)16-6-4-2-3-5-7-16/h8-13,16,22-23H,2-7,14H2,1H3 |
| InChIKey | LVCVFUJFJJQTES-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |