C21H24O4S — CID 10270631
5-(cyclohexylmethyl)-6-(4-methylsulfonylphenyl)-1,3-benzodioxole (PubChem CID 10270631) has the molecular formula C21H24O4S and a molecular weight of 372.49 g/mol. Its IUPAC name is 5-(cyclohexylmethyl)-6-(4-methylsulfonylphenyl)-1,3-benzodioxole.
| Compound Name | 5-(cyclohexylmethyl)-6-(4-methylsulfonylphenyl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 10270631 |
| Molecular Formula | C21H24O4S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 5-(cyclohexylmethyl)-6-(4-methylsulfonylphenyl)-1,3-benzodioxole |
| SMILES | CS(=O)(=O)c1ccc(-c2cc3c(cc2CC2CCCCC2)OCO3)cc1 |
| InChI | InChI=1S/C21H24O4S/c1-26(22,23)18-9-7-16(8-10-18)19-13-21-20(24-14-25-21)12-17(19)11-15-5-3-2-4-6-15/h7-10,12-13,15H,2-6,11,14H2,1H3 |
| InChIKey | OZOQVVJTLCNVSB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |