C12H16F3NO3 — CID 103694284
(1R)-3,3,3-trifluoro-1-(2,4,5-trimethoxyphenyl)propan-1-amine (PubChem CID 103694284) has the molecular formula C12H16F3NO3 and a molecular weight of 279.26 g/mol. Its IUPAC name is (1R)-3,3,3-trifluoro-1-(2,4,5-trimethoxyphenyl)propan-1-amine.
| Compound Name | (1R)-3,3,3-trifluoro-1-(2,4,5-trimethoxyphenyl)propan-1-amine |
|---|---|
| PubChem CID | 103694284 |
| Molecular Formula | C12H16F3NO3 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | (1R)-3,3,3-trifluoro-1-(2,4,5-trimethoxyphenyl)propan-1-amine |
| SMILES | COc1cc(OC)c([C@H](N)CC(F)(F)F)cc1OC |
| InChI | InChI=1S/C12H16F3NO3/c1-17-9-5-11(19-3)10(18-2)4-7(9)8(16)6-12(13,14)15/h4-5,8H,6,16H2,1-3H3/t8-/m1/s1 |
| InChIKey | JQADFVPWHMTCTJ-MRVPVSSYSA-N |
| XLogP | 2.66 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |