C10H15NO3 — CID 83831333
4-(3-amino-1-methoxypropyl)benzene-1,2-diol (PubChem CID 83831333) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is 4-(3-amino-1-methoxypropyl)benzene-1,2-diol.
| Compound Name | 4-(3-amino-1-methoxypropyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 83831333 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 4-(3-amino-1-methoxypropyl)benzene-1,2-diol |
| SMILES | COC(CCN)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C10H15NO3/c1-14-10(4-5-11)7-2-3-8(12)9(13)6-7/h2-3,6,10,12-13H,4-5,11H2,1H3 |
| InChIKey | VDKQYDUIZLZWIN-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|