C24H31NO7 — CID 146356140
[1-[3,4-bis(prop-2-ynoxy)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl] tert-butyl carbonate (PubChem CID 146356140) has the molecular formula C24H31NO7 and a molecular weight of 445.51 g/mol. Its IUPAC name is [1-[3,4-bis(prop-2-ynoxy)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl] tert-butyl carbonate.
| Compound Name | [1-[3,4-bis(prop-2-ynoxy)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl] tert-butyl carbonate |
|---|---|
| PubChem CID | 146356140 |
| Molecular Formula | C24H31NO7 |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | [1-[3,4-bis(prop-2-ynoxy)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl] tert-butyl carbonate |
| SMILES | C#CCOc1ccc(C(CNC(=O)OC(C)(C)C)OC(=O)OC(C)(C)C)cc1OCC#C |
| InChI | InChI=1S/C24H31NO7/c1-9-13-28-18-12-11-17(15-19(18)29-14-10-2)20(30-22(27)32-24(6,7)8)16-25-21(26)31-23(3,4)5/h1-2,11-12,15,20H,13-14,16H2,3-8H3,(H,25,26) |
| InChIKey | HZJRRTUEGCQWPY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|