C18H23ClN2O4S — CID 138734132
3-chloro-1-N-[(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]benzene-1,2-diamine (PubChem CID 138734132) has the molecular formula C18H23ClN2O4S and a molecular weight of 398.91 g/mol. Its IUPAC name is 3-chloro-1-N-[(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]benzene-1,2-diamine.
| Compound Name | 3-chloro-1-N-[(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 138734132 |
| Molecular Formula | C18H23ClN2O4S |
| Molecular Weight | 398.91 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 3-chloro-1-N-[(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]benzene-1,2-diamine |
| SMILES | CCOc1cc([C@@H](CS(C)(=O)=O)Nc2cccc(Cl)c2N)ccc1OC |
| InChI | InChI=1S/C18H23ClN2O4S/c1-4-25-17-10-12(8-9-16(17)24-2)15(11-26(3,22)23)21-14-7-5-6-13(19)18(14)20/h5-10,15,21H,4,11,20H2,1-3H3/t15-/m1/s1 |
| InChIKey | WHIYAYSIATWRBB-OAHLLOKOSA-N |
| XLogP | 3.53 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.91 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|