C18H21BrN2O6S — CID 142292007
3-bromo-N-[(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-2-nitroaniline (PubChem CID 142292007) has the molecular formula C18H21BrN2O6S and a molecular weight of 473.35 g/mol. Its IUPAC name is 3-bromo-N-[(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-2-nitroaniline.
| Compound Name | 3-bromo-N-[(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-2-nitroaniline |
|---|---|
| PubChem CID | 142292007 |
| Molecular Formula | C18H21BrN2O6S |
| Molecular Weight | 473.35 g/mol |
| Exact Mass | 472.03 |
| IUPAC Name | 3-bromo-N-[(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-2-nitroaniline |
| SMILES | CCOc1cc([C@@H](CS(C)(=O)=O)Nc2cccc(Br)c2[N+](=O)[O-])ccc1OC |
| InChI | InChI=1S/C18H21BrN2O6S/c1-4-27-17-10-12(8-9-16(17)26-2)15(11-28(3,24)25)20-14-7-5-6-13(19)18(14)21(22)23/h5-10,15,20H,4,11H2,1-3H3/t15-/m1/s1 |
| InChIKey | YDBYPMSGQOODET-OAHLLOKOSA-N |
| XLogP | 3.96 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|