C22H24N2O6S2 — CID 162038961
2-[3-[(2S)-2-(3-ethoxy-4-methoxyphenyl)-3-methylsulfonylpropyl]-2-nitrophenyl]-1,3-thiazole (PubChem CID 162038961) has the molecular formula C22H24N2O6S2 and a molecular weight of 476.58 g/mol. Its IUPAC name is 2-[3-[(2S)-2-(3-ethoxy-4-methoxyphenyl)-3-methylsulfonylpropyl]-2-nitrophenyl]-1,3-thiazole.
| Compound Name | 2-[3-[(2S)-2-(3-ethoxy-4-methoxyphenyl)-3-methylsulfonylpropyl]-2-nitrophenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 162038961 |
| Molecular Formula | C22H24N2O6S2 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 2-[3-[(2S)-2-(3-ethoxy-4-methoxyphenyl)-3-methylsulfonylpropyl]-2-nitrophenyl]-1,3-thiazole |
| SMILES | CCOc1cc([C@H](Cc2cccc(-c3nccs3)c2[N+](=O)[O-])CS(C)(=O)=O)ccc1OC |
| InChI | InChI=1S/C22H24N2O6S2/c1-4-30-20-13-15(8-9-19(20)29-2)17(14-32(3,27)28)12-16-6-5-7-18(21(16)24(25)26)22-23-10-11-31-22/h5-11,13,17H,4,12,14H2,1-3H3/t17-/m1/s1 |
| InChIKey | ZGXHPPQIZXPNSO-QGZVFWFLSA-N |
| XLogP | 4.50 |
| TPSA | 108.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|