C19H19N3O4S — CID 142292070
N-[(3-ethoxy-4-methoxyphenyl)methyl]-2-nitro-3-(1,3-thiazol-2-yl)aniline (PubChem CID 142292070) has the molecular formula C19H19N3O4S and a molecular weight of 385.45 g/mol. Its IUPAC name is N-[(3-ethoxy-4-methoxyphenyl)methyl]-2-nitro-3-(1,3-thiazol-2-yl)aniline.
| Compound Name | N-[(3-ethoxy-4-methoxyphenyl)methyl]-2-nitro-3-(1,3-thiazol-2-yl)aniline |
|---|---|
| PubChem CID | 142292070 |
| Molecular Formula | C19H19N3O4S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | N-[(3-ethoxy-4-methoxyphenyl)methyl]-2-nitro-3-(1,3-thiazol-2-yl)aniline |
| SMILES | CCOc1cc(CNc2cccc(-c3nccs3)c2[N+](=O)[O-])ccc1OC |
| InChI | InChI=1S/C19H19N3O4S/c1-3-26-17-11-13(7-8-16(17)25-2)12-21-15-6-4-5-14(18(15)22(23)24)19-20-9-10-27-19/h4-11,21H,3,12H2,1-2H3 |
| InChIKey | WQINFEWZDYSCQT-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|