About N-[(3-ethoxy-4-methoxyphenyl)methyl]-2-nitro-3-pyrazol-1-ylaniline;methylsulfanylmethane
N-[(3-ethoxy-4-methoxyphenyl)methyl]-2-nitro-3-pyrazol-1-ylaniline;methylsulfanylmethane (PubChem CID 142292081) has the molecular formula C21H26N4O4S
and a molecular weight of 430.53 g/mol. Its IUPAC name is N-[(3-ethoxy-4-methoxyphenyl)methyl]-2-nitro-3-pyrazol-1-ylaniline;methylsulfanylmethane.
Molecular Properties
| Compound Name | N-[(3-ethoxy-4-methoxyphenyl)methyl]-2-nitro-3-pyrazol-1-ylaniline;methylsulfanylmethane |
| PubChem CID | 142292081 |
| Molecular Formula | C21H26N4O4S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | N-[(3-ethoxy-4-methoxyphenyl)methyl]-2-nitro-3-pyrazol-1-ylaniline;methylsulfanylmethane |
| SMILES | CCOc1cc(CNc2cccc(-n3cccn3)c2[N+](=O)[O-])ccc1OC.CSC |
| InChI | InChI=1S/C19H20N4O4.C2H6S/c1-3-27-18-12-14(8-9-17(18)26-2)13-20-15-6-4-7-16(19(15)23(24)25)22-11-5-10-21-22;1-3-2/h4-12,20H,3,13H2,1-2H3;1-2H3 |
| InChIKey | QMZOGZQVDMAXSD-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 91.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(3-ethoxy-4-methoxyphenyl)methyl]-2-nitro-3-pyrazol-1-ylaniline;methylsulfanylmethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-ethoxy-4-methoxyphenyl)methyl]-2-nitro-3-pyrazol-1-ylaniline;methylsulfanylmethane?
The IUPAC name of N-[(3-ethoxy-4-methoxyphenyl)methyl]-2-nitro-3-pyrazol-1-ylaniline;methylsulfanylmethane (CID 142292081) is N-[(3-ethoxy-4-methoxyphenyl)methyl]-2-nitro-3-pyrazol-1-ylaniline;methylsulfanylmethane.
What is the SMILES notation for N-[(3-ethoxy-4-methoxyphenyl)methyl]-2-nitro-3-pyrazol-1-ylaniline;methylsulfanylmethane?
The canonical SMILES for N-[(3-ethoxy-4-methoxyphenyl)methyl]-2-nitro-3-pyrazol-1-ylaniline;methylsulfanylmethane is CCOc1cc(CNc2cccc(-n3cccn3)c2[N+](=O)[O-])ccc1OC.CSC.
What is the InChIKey of N-[(3-ethoxy-4-methoxyphenyl)methyl]-2-nitro-3-pyrazol-1-ylaniline;methylsulfanylmethane?
The InChIKey is QMZOGZQVDMAXSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4O4.C2H6S/c1-3-27-18-12-14(8-9-17(18)26-2)13-20-15-6-4-7-16(19(15)23(24)25)22-11-5-10-21-22;1-3-2/h4-12,20H,3,13H2,1-2H3;1-2H3.
What are the key properties of N-[(3-ethoxy-4-methoxyphenyl)methyl]-2-nitro-3-pyrazol-1-ylaniline;methylsulfanylmethane?
N-[(3-ethoxy-4-methoxyphenyl)methyl]-2-nitro-3-pyrazol-1-ylaniline;methylsulfanylmethane has a molecular weight of 430.53 g/mol, XLogP of 4.78, 8 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-ethoxy-4-methoxyphenyl)methyl]-2-nitro-3-pyrazol-1-ylaniline;methylsulfanylmethane is sourced from PubChem (CID 142292081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).