C19H22FNO6S — CID 159981976
2-ethoxy-4-[(2S)-1-(4-fluoro-2-nitrophenyl)-3-methylsulfonylpropan-2-yl]-1-methoxybenzene (PubChem CID 159981976) has the molecular formula C19H22FNO6S and a molecular weight of 411.45 g/mol. Its IUPAC name is 2-ethoxy-4-[(2S)-1-(4-fluoro-2-nitrophenyl)-3-methylsulfonylpropan-2-yl]-1-methoxybenzene.
| Compound Name | 2-ethoxy-4-[(2S)-1-(4-fluoro-2-nitrophenyl)-3-methylsulfonylpropan-2-yl]-1-methoxybenzene |
|---|---|
| PubChem CID | 159981976 |
| Molecular Formula | C19H22FNO6S |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 2-ethoxy-4-[(2S)-1-(4-fluoro-2-nitrophenyl)-3-methylsulfonylpropan-2-yl]-1-methoxybenzene |
| SMILES | CCOc1cc([C@H](Cc2ccc(F)cc2[N+](=O)[O-])CS(C)(=O)=O)ccc1OC |
| InChI | InChI=1S/C19H22FNO6S/c1-4-27-19-10-13(6-8-18(19)26-2)15(12-28(3,24)25)9-14-5-7-16(20)11-17(14)21(22)23/h5-8,10-11,15H,4,9,12H2,1-3H3/t15-/m1/s1 |
| InChIKey | OVKTZIHTJWSBHH-OAHLLOKOSA-N |
| XLogP | 3.51 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|