C24H24F2N2O6S — CID 157144216
2-[2-[4-(difluoromethoxy)-3-ethoxyphenyl]-3-methylsulfonylpropyl]-3-nitro-4-phenylpyridine (PubChem CID 157144216) has the molecular formula C24H24F2N2O6S and a molecular weight of 506.53 g/mol. Its IUPAC name is 2-[2-[4-(difluoromethoxy)-3-ethoxyphenyl]-3-methylsulfonylpropyl]-3-nitro-4-phenylpyridine.
| Compound Name | 2-[2-[4-(difluoromethoxy)-3-ethoxyphenyl]-3-methylsulfonylpropyl]-3-nitro-4-phenylpyridine |
|---|---|
| PubChem CID | 157144216 |
| Molecular Formula | C24H24F2N2O6S |
| Molecular Weight | 506.53 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | 2-[2-[4-(difluoromethoxy)-3-ethoxyphenyl]-3-methylsulfonylpropyl]-3-nitro-4-phenylpyridine |
| SMILES | CCOc1cc(C(Cc2nccc(-c3ccccc3)c2[N+](=O)[O-])CS(C)(=O)=O)ccc1OC(F)F |
| InChI | InChI=1S/C24H24F2N2O6S/c1-3-33-22-14-17(9-10-21(22)34-24(25)26)18(15-35(2,31)32)13-20-23(28(29)30)19(11-12-27-20)16-7-5-4-6-8-16/h4-12,14,18,24H,3,13,15H2,1-2H3 |
| InChIKey | LGVBMCFZTLFHMS-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 108.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.53 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|