C22H28N4O4S — CID 138735204
1-N-[(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-3-(1-methylpyrazol-4-yl)benzene-1,2-diamine (PubChem CID 138735204) has the molecular formula C22H28N4O4S and a molecular weight of 444.56 g/mol. Its IUPAC name is 1-N-[(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-3-(1-methylpyrazol-4-yl)benzene-1,2-diamine.
| Compound Name | 1-N-[(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-3-(1-methylpyrazol-4-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 138735204 |
| Molecular Formula | C22H28N4O4S |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 1-N-[(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-3-(1-methylpyrazol-4-yl)benzene-1,2-diamine |
| SMILES | CCOc1cc([C@@H](CS(C)(=O)=O)Nc2cccc(-c3cnn(C)c3)c2N)ccc1OC |
| InChI | InChI=1S/C22H28N4O4S/c1-5-30-21-11-15(9-10-20(21)29-3)19(14-31(4,27)28)25-18-8-6-7-17(22(18)23)16-12-24-26(2)13-16/h6-13,19,25H,5,14,23H2,1-4H3/t19-/m1/s1 |
| InChIKey | CZIFDOASLBUYOQ-LJQANCHMSA-N |
| XLogP | 3.27 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|