C11H18N2O4S — CID 105301180
[1-(3,4-dimethoxyphenyl)-2-methylsulfonylethyl]hydrazine (PubChem CID 105301180) has the molecular formula C11H18N2O4S and a molecular weight of 274.34 g/mol. Its IUPAC name is [1-(3,4-dimethoxyphenyl)-2-methylsulfonylethyl]hydrazine.
| Compound Name | [1-(3,4-dimethoxyphenyl)-2-methylsulfonylethyl]hydrazine |
|---|---|
| PubChem CID | 105301180 |
| Molecular Formula | C11H18N2O4S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | [1-(3,4-dimethoxyphenyl)-2-methylsulfonylethyl]hydrazine |
| SMILES | COc1ccc(C(CS(C)(=O)=O)NN)cc1OC |
| InChI | InChI=1S/C11H18N2O4S/c1-16-10-5-4-8(6-11(10)17-2)9(13-12)7-18(3,14)15/h4-6,9,13H,7,12H2,1-3H3 |
| InChIKey | NHVLCTSWKPHGJJ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|