C16H22O4S2 — CID 140797805
(2R)-2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-2,5-dihydrothiophene (PubChem CID 140797805) has the molecular formula C16H22O4S2 and a molecular weight of 342.48 g/mol. Its IUPAC name is (2R)-2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-2,5-dihydrothiophene.
| Compound Name | (2R)-2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-2,5-dihydrothiophene |
|---|---|
| PubChem CID | 140797805 |
| Molecular Formula | C16H22O4S2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | (2R)-2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-2,5-dihydrothiophene |
| SMILES | CCOc1cc(C(CS(C)(=O)=O)[C@H]2C=CCS2)ccc1OC |
| InChI | InChI=1S/C16H22O4S2/c1-4-20-15-10-12(7-8-14(15)19-2)13(11-22(3,17)18)16-6-5-9-21-16/h5-8,10,13,16H,4,9,11H2,1-3H3/t13?,16-/m1/s1 |
| InChIKey | YLPHDEWRSSMOBM-FQNRMIAFSA-N |
| XLogP | 2.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|