C13H17BrF3NO2 — CID 63826770
1-(3-bromo-4-methoxyphenyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]ethanamine (PubChem CID 63826770) has the molecular formula C13H17BrF3NO2 and a molecular weight of 356.18 g/mol. Its IUPAC name is 1-(3-bromo-4-methoxyphenyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]ethanamine.
| Compound Name | 1-(3-bromo-4-methoxyphenyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]ethanamine |
|---|---|
| PubChem CID | 63826770 |
| Molecular Formula | C13H17BrF3NO2 |
| Molecular Weight | 356.18 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 1-(3-bromo-4-methoxyphenyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]ethanamine |
| SMILES | COc1ccc(C(C)NCCOCC(F)(F)F)cc1Br |
| InChI | InChI=1S/C13H17BrF3NO2/c1-9(18-5-6-20-8-13(15,16)17)10-3-4-12(19-2)11(14)7-10/h3-4,7,9,18H,5-6,8H2,1-2H3 |
| InChIKey | PMKRXVIYOMUZKW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.18 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|