C15H25BrN2O2 — CID 107094299
1-(3-bromo-4-methoxyphenyl)-N-[2-[2-(dimethylamino)ethoxy]ethyl]ethanamine (PubChem CID 107094299) has the molecular formula C15H25BrN2O2 and a molecular weight of 345.28 g/mol. Its IUPAC name is 1-(3-bromo-4-methoxyphenyl)-N-[2-[2-(dimethylamino)ethoxy]ethyl]ethanamine.
| Compound Name | 1-(3-bromo-4-methoxyphenyl)-N-[2-[2-(dimethylamino)ethoxy]ethyl]ethanamine |
|---|---|
| PubChem CID | 107094299 |
| Molecular Formula | C15H25BrN2O2 |
| Molecular Weight | 345.28 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 1-(3-bromo-4-methoxyphenyl)-N-[2-[2-(dimethylamino)ethoxy]ethyl]ethanamine |
| SMILES | COc1ccc(C(C)NCCOCCN(C)C)cc1Br |
| InChI | InChI=1S/C15H25BrN2O2/c1-12(17-7-9-20-10-8-18(2)3)13-5-6-15(19-4)14(16)11-13/h5-6,11-12,17H,7-10H2,1-4H3 |
| InChIKey | XOYQQCPASUBWKG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|