C12H14ClF4NO — CID 82994637
1-(4-chloro-3-fluorophenyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]ethanamine (PubChem CID 82994637) has the molecular formula C12H14ClF4NO and a molecular weight of 299.70 g/mol. Its IUPAC name is 1-(4-chloro-3-fluorophenyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]ethanamine.
| Compound Name | 1-(4-chloro-3-fluorophenyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]ethanamine |
|---|---|
| PubChem CID | 82994637 |
| Molecular Formula | C12H14ClF4NO |
| Molecular Weight | 299.70 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 1-(4-chloro-3-fluorophenyl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]ethanamine |
| SMILES | CC(NCCOCC(F)(F)F)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C12H14ClF4NO/c1-8(9-2-3-10(13)11(14)6-9)18-4-5-19-7-12(15,16)17/h2-3,6,8,18H,4-5,7H2,1H3 |
| InChIKey | MNCJZQWEWKJCKZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.70 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|