C12H15F4NO2 — CID 63828726
5-fluoro-2-[1-[2-(2,2,2-trifluoroethoxy)ethylamino]ethyl]phenol (PubChem CID 63828726) has the molecular formula C12H15F4NO2 and a molecular weight of 281.25 g/mol. Its IUPAC name is 5-fluoro-2-[1-[2-(2,2,2-trifluoroethoxy)ethylamino]ethyl]phenol.
| Compound Name | 5-fluoro-2-[1-[2-(2,2,2-trifluoroethoxy)ethylamino]ethyl]phenol |
|---|---|
| PubChem CID | 63828726 |
| Molecular Formula | C12H15F4NO2 |
| Molecular Weight | 281.25 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 5-fluoro-2-[1-[2-(2,2,2-trifluoroethoxy)ethylamino]ethyl]phenol |
| SMILES | CC(NCCOCC(F)(F)F)c1ccc(F)cc1O |
| InChI | InChI=1S/C12H15F4NO2/c1-8(10-3-2-9(13)6-11(10)18)17-4-5-19-7-12(14,15)16/h2-3,6,8,17-18H,4-5,7H2,1H3 |
| InChIKey | NHXVKFZEZTVEFL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.25 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|