C10H11F4NO — CID 63064753
5-fluoro-2-[1-(2,2,2-trifluoroethylamino)ethyl]phenol (PubChem CID 63064753) has the molecular formula C10H11F4NO and a molecular weight of 237.20 g/mol. Its IUPAC name is 5-fluoro-2-[1-(2,2,2-trifluoroethylamino)ethyl]phenol.
| Compound Name | 5-fluoro-2-[1-(2,2,2-trifluoroethylamino)ethyl]phenol |
|---|---|
| PubChem CID | 63064753 |
| Molecular Formula | C10H11F4NO |
| Molecular Weight | 237.20 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 5-fluoro-2-[1-(2,2,2-trifluoroethylamino)ethyl]phenol |
| SMILES | CC(NCC(F)(F)F)c1ccc(F)cc1O |
| InChI | InChI=1S/C10H11F4NO/c1-6(15-5-10(12,13)14)8-3-2-7(11)4-9(8)16/h2-4,6,15-16H,5H2,1H3 |
| InChIKey | VRYVGLAXENAYLW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.20 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|