C34H41F24I3 — CID 166921781
10,10,11,11,12,12,13,13,14,14,15,15,25,25,26,26,27,27,28,28,29,29,30,30-tetracosafluoro-7,17,22-triiodo-9,9,24,24-tetramethyltriacont-1-ene (PubChem CID 166921781) has the molecular formula C34H41F24I3 and a molecular weight of 1286.37 g/mol. Its IUPAC name is 10,10,11,11,12,12,13,13,14,14,15,15,25,25,26,26,27,27,28,28,29,29,30,30-tetracosafluoro-7,17,22-triiodo-9,9,24,24-tetramethyltriacont-1-ene.
| Compound Name | 10,10,11,11,12,12,13,13,14,14,15,15,25,25,26,26,27,27,28,28,29,29,30,30-tetracosafluoro-7,17,22-triiodo-9,9,24,24-tetramethyltriacont-1-ene |
|---|---|
| PubChem CID | 166921781 |
| Molecular Formula | C34H41F24I3 |
| Molecular Weight | 1286.37 g/mol |
| Exact Mass | 1286.00 |
| IUPAC Name | 10,10,11,11,12,12,13,13,14,14,15,15,25,25,26,26,27,27,28,28,29,29,30,30-tetracosafluoro-7,17,22-triiodo-9,9,24,24-tetramethyltriacont-1-ene |
| SMILES | C=CCCCCC(I)CC(C)(C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC(I)CCCCC(I)CC(C)(C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C34H41F24I3/c1-6-7-8-9-12-18(59)15-23(4,5)27(43,44)31(51,52)34(57,58)32(53,54)28(45,46)24(37,38)17-20(61)14-11-10-13-19(60)16-22(2,3)26(41,42)30(49,50)33(55,56)29(47,48)25(39,40)21(35)36/h6,18-21H,1,7-17H2,2-5H3 |
| InChIKey | HWVZHDLORBFUDA-UHFFFAOYSA-N |
| XLogP | 17.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 28 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1286.37 |
| LogP ≤ 5 | 17.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|