C21H21F20IO6S — CID 91171609
12,12,13,13,14,14,15,15,16,16,17,17,18,18,19,19-hexadecafluoro-10-iodo-2-(1,1,2,2-tetrafluoro-2-sulfoethoxy)nonadecanoic acid (PubChem CID 91171609) has the molecular formula C21H21F20IO6S and a molecular weight of 908.32 g/mol. Its IUPAC name is 12,12,13,13,14,14,15,15,16,16,17,17,18,18,19,19-hexadecafluoro-10-iodo-2-(1,1,2,2-tetrafluoro-2-sulfoethoxy)nonadecanoic acid.
| Compound Name | 12,12,13,13,14,14,15,15,16,16,17,17,18,18,19,19-hexadecafluoro-10-iodo-2-(1,1,2,2-tetrafluoro-2-sulfoethoxy)nonadecanoic acid |
|---|---|
| PubChem CID | 91171609 |
| Molecular Formula | C21H21F20IO6S |
| Molecular Weight | 908.32 g/mol |
| Exact Mass | 907.98 |
| IUPAC Name | 12,12,13,13,14,14,15,15,16,16,17,17,18,18,19,19-hexadecafluoro-10-iodo-2-(1,1,2,2-tetrafluoro-2-sulfoethoxy)nonadecanoic acid |
| SMILES | O=C(O)C(CCCCCCCC(I)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)OC(F)(F)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C21H21F20IO6S/c22-12(23)14(26,27)16(30,31)18(34,35)19(36,37)17(32,33)15(28,29)13(24,25)8-9(42)6-4-2-1-3-5-7-10(11(43)44)48-20(38,39)21(40,41)49(45,46)47/h9-10,12H,1-8H2,(H,43,44)(H,45,46,47) |
| InChIKey | ZXDONDJOSWITCQ-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 908.32 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|