C17H24FN3O2 — CID 7547670
3-[(3R)-1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl]-1,1-dipropylurea (PubChem CID 7547670) has the molecular formula C17H24FN3O2 and a molecular weight of 321.40 g/mol. Its IUPAC name is 3-[(3R)-1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl]-1,1-dipropylurea.
| Compound Name | 3-[(3R)-1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl]-1,1-dipropylurea |
|---|---|
| PubChem CID | 7547670 |
| Molecular Formula | C17H24FN3O2 |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 3-[(3R)-1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl]-1,1-dipropylurea |
| SMILES | CCCN(CCC)C(=O)N[C@@H]1CC(=O)N(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C17H24FN3O2/c1-3-9-20(10-4-2)17(23)19-14-11-16(22)21(12-14)15-7-5-13(18)6-8-15/h5-8,14H,3-4,9-12H2,1-2H3,(H,19,23)/t14-/m1/s1 |
| InChIKey | OAMDRRPZDRSSNQ-CQSZACIVSA-N |
| XLogP | 2.76 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |