C15H18Cl2FN3O2 — CID 43970247
1,1-bis(2-chloroethyl)-3-[1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl]urea (PubChem CID 43970247) has the molecular formula C15H18Cl2FN3O2 and a molecular weight of 362.23 g/mol. Its IUPAC name is 1,1-bis(2-chloroethyl)-3-[1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl]urea.
| Compound Name | 1,1-bis(2-chloroethyl)-3-[1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 43970247 |
| Molecular Formula | C15H18Cl2FN3O2 |
| Molecular Weight | 362.23 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 1,1-bis(2-chloroethyl)-3-[1-(4-fluorophenyl)-5-oxopyrrolidin-3-yl]urea |
| SMILES | O=C(NC1CC(=O)N(c2ccc(F)cc2)C1)N(CCCl)CCCl |
| InChI | InChI=1S/C15H18Cl2FN3O2/c16-5-7-20(8-6-17)15(23)19-12-9-14(22)21(10-12)13-3-1-11(18)2-4-13/h1-4,12H,5-10H2,(H,19,23) |
| InChIKey | UYTYCOLATHQDRT-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.23 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|