C20H19N3OS — CID 17335812
3,4-dimethyl-N-[(2-methylquinolin-5-yl)carbamothioyl]benzamide (PubChem CID 17335812) has the molecular formula C20H19N3OS and a molecular weight of 349.46 g/mol. Its IUPAC name is 3,4-dimethyl-N-[(2-methylquinolin-5-yl)carbamothioyl]benzamide.
| Compound Name | 3,4-dimethyl-N-[(2-methylquinolin-5-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17335812 |
| Molecular Formula | C20H19N3OS |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 3,4-dimethyl-N-[(2-methylquinolin-5-yl)carbamothioyl]benzamide |
| SMILES | Cc1ccc2c(NC(=S)NC(=O)c3ccc(C)c(C)c3)cccc2n1 |
| InChI | InChI=1S/C20H19N3OS/c1-12-7-9-15(11-13(12)2)19(24)23-20(25)22-18-6-4-5-17-16(18)10-8-14(3)21-17/h4-11H,1-3H3,(H2,22,23,24,25) |
| InChIKey | NUGMPLPACDQZEQ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|