C17H17N3O2S — CID 888847
N-[(2-carbamoylphenyl)carbamothioyl]-3,4-dimethylbenzamide (PubChem CID 888847) has the molecular formula C17H17N3O2S and a molecular weight of 327.41 g/mol. Its IUPAC name is N-[(2-carbamoylphenyl)carbamothioyl]-3,4-dimethylbenzamide.
| Compound Name | N-[(2-carbamoylphenyl)carbamothioyl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 888847 |
| Molecular Formula | C17H17N3O2S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | N-[(2-carbamoylphenyl)carbamothioyl]-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(=S)Nc2ccccc2C(N)=O)cc1C |
| InChI | InChI=1S/C17H17N3O2S/c1-10-7-8-12(9-11(10)2)16(22)20-17(23)19-14-6-4-3-5-13(14)15(18)21/h3-9H,1-2H3,(H2,18,21)(H2,19,20,22,23) |
| InChIKey | XRNIJARUAYQRKT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|