C20H10Cl2F6N2O2S — CID 17315310
N-[[3,5-bis(trifluoromethyl)phenyl]carbamothioyl]-5-(3,4-dichlorophenyl)furan-2-carboxamide (PubChem CID 17315310) has the molecular formula C20H10Cl2F6N2O2S and a molecular weight of 527.27 g/mol. Its IUPAC name is N-[[3,5-bis(trifluoromethyl)phenyl]carbamothioyl]-5-(3,4-dichlorophenyl)furan-2-carboxamide.
| Compound Name | N-[[3,5-bis(trifluoromethyl)phenyl]carbamothioyl]-5-(3,4-dichlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17315310 |
| Molecular Formula | C20H10Cl2F6N2O2S |
| Molecular Weight | 527.27 g/mol |
| Exact Mass | 525.97 |
| IUPAC Name | N-[[3,5-bis(trifluoromethyl)phenyl]carbamothioyl]-5-(3,4-dichlorophenyl)furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccc(-c2ccc(Cl)c(Cl)c2)o1 |
| InChI | InChI=1S/C20H10Cl2F6N2O2S/c21-13-2-1-9(5-14(13)22)15-3-4-16(32-15)17(31)30-18(33)29-12-7-10(19(23,24)25)6-11(8-12)20(26,27)28/h1-8H,(H2,29,30,31,33) |
| InChIKey | GGKPGTYHLDQCII-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.27 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|