C20H15ClF3N3O2S — CID 18871714
1-[[5-[4-chloro-3-(trifluoromethyl)phenyl]furan-2-carbonyl]amino]-3-(4-methylphenyl)thiourea (PubChem CID 18871714) has the molecular formula C20H15ClF3N3O2S and a molecular weight of 453.87 g/mol. Its IUPAC name is 1-[[5-[4-chloro-3-(trifluoromethyl)phenyl]furan-2-carbonyl]amino]-3-(4-methylphenyl)thiourea.
| Compound Name | 1-[[5-[4-chloro-3-(trifluoromethyl)phenyl]furan-2-carbonyl]amino]-3-(4-methylphenyl)thiourea |
|---|---|
| PubChem CID | 18871714 |
| Molecular Formula | C20H15ClF3N3O2S |
| Molecular Weight | 453.87 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | 1-[[5-[4-chloro-3-(trifluoromethyl)phenyl]furan-2-carbonyl]amino]-3-(4-methylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)NNC(=O)c2ccc(-c3ccc(Cl)c(C(F)(F)F)c3)o2)cc1 |
| InChI | InChI=1S/C20H15ClF3N3O2S/c1-11-2-5-13(6-3-11)25-19(30)27-26-18(28)17-9-8-16(29-17)12-4-7-15(21)14(10-12)20(22,23)24/h2-10H,1H3,(H,26,28)(H2,25,27,30) |
| InChIKey | QLXOTKVULLORQX-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 66.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.87 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|