C15H13ClF3NO2 — CID 1253325
5-[4-chloro-3-(trifluoromethyl)phenyl]-N-propan-2-ylfuran-2-carboxamide (PubChem CID 1253325) has the molecular formula C15H13ClF3NO2 and a molecular weight of 331.72 g/mol. Its IUPAC name is 5-[4-chloro-3-(trifluoromethyl)phenyl]-N-propan-2-ylfuran-2-carboxamide.
| Compound Name | 5-[4-chloro-3-(trifluoromethyl)phenyl]-N-propan-2-ylfuran-2-carboxamide |
|---|---|
| PubChem CID | 1253325 |
| Molecular Formula | C15H13ClF3NO2 |
| Molecular Weight | 331.72 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 5-[4-chloro-3-(trifluoromethyl)phenyl]-N-propan-2-ylfuran-2-carboxamide |
| SMILES | CC(C)NC(=O)c1ccc(-c2ccc(Cl)c(C(F)(F)F)c2)o1 |
| InChI | InChI=1S/C15H13ClF3NO2/c1-8(2)20-14(21)13-6-5-12(22-13)9-3-4-11(16)10(7-9)15(17,18)19/h3-8H,1-2H3,(H,20,21) |
| InChIKey | IINKSJDBWCBUKJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.72 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |