C14H8ClF3O3 — CID 67169287
(E)-3-[5-[4-chloro-3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-enoic acid (PubChem CID 67169287) has the molecular formula C14H8ClF3O3 and a molecular weight of 316.66 g/mol. Its IUPAC name is (E)-3-[5-[4-chloro-3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-[4-chloro-3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 67169287 |
| Molecular Formula | C14H8ClF3O3 |
| Molecular Weight | 316.66 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | (E)-3-[5-[4-chloro-3-(trifluoromethyl)phenyl]furan-2-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(-c2ccc(Cl)c(C(F)(F)F)c2)o1 |
| InChI | InChI=1S/C14H8ClF3O3/c15-11-4-1-8(7-10(11)14(16,17)18)12-5-2-9(21-12)3-6-13(19)20/h1-7H,(H,19,20)/b6-3+ |
| InChIKey | JIHXSFBLZFFTAF-ZZXKWVIFSA-N |
| XLogP | 4.72 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.66 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|