C13H7Cl3O3 — CID 53401800
3-[5-(2,4,5-trichlorophenyl)furan-2-yl]prop-2-enoic acid (PubChem CID 53401800) has the molecular formula C13H7Cl3O3 and a molecular weight of 317.56 g/mol. Its IUPAC name is 3-[5-(2,4,5-trichlorophenyl)furan-2-yl]prop-2-enoic acid.
| Compound Name | 3-[5-(2,4,5-trichlorophenyl)furan-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 53401800 |
| Molecular Formula | C13H7Cl3O3 |
| Molecular Weight | 317.56 g/mol |
| Exact Mass | 315.95 |
| IUPAC Name | 3-[5-(2,4,5-trichlorophenyl)furan-2-yl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(-c2cc(Cl)c(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C13H7Cl3O3/c14-9-6-11(16)10(15)5-8(9)12-3-1-7(19-12)2-4-13(17)18/h1-6H,(H,17,18) |
| InChIKey | BVSRGPYASWRSFF-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.56 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|