3-[5-(2,4,5-trichlorophenyl)furan-2-yl]prop-2-enoic acid

C13H7Cl3O3 — CID 53401800

IUPAC3-[5-(2,4,5-trichlorophenyl)furan-2-yl]prop-2-enoic acid
SMILESO=C(O)C=Cc1ccc(-c2cc(Cl)c(Cl)cc2Cl)o1
InChIInChI=1S/C13H7Cl3O3/c14-9-6-11(16)10(15)5-8(9)12-3-1-7(19-12)2-4-13(17)18/h1-6H,(H,17,18)
InChIKeyBVSRGPYASWRSFF-UHFFFAOYSA-N
MW317.56 g/mol
LogP5.00
Rot. Bonds3

About 3-[5-(2,4,5-trichlorophenyl)furan-2-yl]prop-2-enoic acid

3-[5-(2,4,5-trichlorophenyl)furan-2-yl]prop-2-enoic acid (PubChem CID 53401800) has the molecular formula C13H7Cl3O3 and a molecular weight of 317.56 g/mol. Its IUPAC name is 3-[5-(2,4,5-trichlorophenyl)furan-2-yl]prop-2-enoic acid.

Molecular Properties

Compound Name3-[5-(2,4,5-trichlorophenyl)furan-2-yl]prop-2-enoic acid
PubChem CID53401800
Molecular FormulaC13H7Cl3O3
Molecular Weight317.56 g/mol
Exact Mass315.95
IUPAC Name3-[5-(2,4,5-trichlorophenyl)furan-2-yl]prop-2-enoic acid
SMILESO=C(O)C=Cc1ccc(-c2cc(Cl)c(Cl)cc2Cl)o1
InChIInChI=1S/C13H7Cl3O3/c14-9-6-11(16)10(15)5-8(9)12-3-1-7(19-12)2-4-13(17)18/h1-6H,(H,17,18)
InChIKeyBVSRGPYASWRSFF-UHFFFAOYSA-N
XLogP5.00
TPSA50.44 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500317.56
LogP ≤ 55.00
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 3-[5-(2,4,5-trichlorophenyl)furan-2-yl]prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[5-(2,4,5-trichlorophenyl)furan-2-yl]prop-2-enoic acid?
The IUPAC name of 3-[5-(2,4,5-trichlorophenyl)furan-2-yl]prop-2-enoic acid (CID 53401800) is 3-[5-(2,4,5-trichlorophenyl)furan-2-yl]prop-2-enoic acid.
What is the SMILES notation for 3-[5-(2,4,5-trichlorophenyl)furan-2-yl]prop-2-enoic acid?
The canonical SMILES for 3-[5-(2,4,5-trichlorophenyl)furan-2-yl]prop-2-enoic acid is O=C(O)C=Cc1ccc(-c2cc(Cl)c(Cl)cc2Cl)o1.
What is the InChIKey of 3-[5-(2,4,5-trichlorophenyl)furan-2-yl]prop-2-enoic acid?
The InChIKey is BVSRGPYASWRSFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7Cl3O3/c14-9-6-11(16)10(15)5-8(9)12-3-1-7(19-12)2-4-13(17)18/h1-6H,(H,17,18).
What are the key properties of 3-[5-(2,4,5-trichlorophenyl)furan-2-yl]prop-2-enoic acid?
3-[5-(2,4,5-trichlorophenyl)furan-2-yl]prop-2-enoic acid has a molecular weight of 317.56 g/mol, XLogP of 5.00, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(2,4,5-trichlorophenyl)furan-2-yl]prop-2-enoic acid is sourced from PubChem (CID 53401800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).